C10H14ClN5 — CID 114660153
1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(3-methylimidazol-4-yl)methanamine (PubChem CID 114660153) has the molecular formula C10H14ClN5 and a molecular weight of 239.71 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(3-methylimidazol-4-yl)methanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(3-methylimidazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114660153 |
| Molecular Formula | C10H14ClN5 |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-1-(3-methylimidazol-4-yl)methanamine |
| SMILES | CNC(c1cncn1C)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H14ClN5/c1-12-9(8-5-13-6-15(8)2)10-7(11)4-14-16(10)3/h4-6,9,12H,1-3H3 |
| InChIKey | JRZAVAHXHQOSSW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |