C13H16BrClN4 — CID 114660511
N-[(5-bromo-2-pyridinyl)-(4-chloro-1-ethylpyrazol-5-yl)methyl]ethanamine (PubChem CID 114660511) has the molecular formula C13H16BrClN4 and a molecular weight of 343.66 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)-(4-chloro-1-ethylpyrazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-2-pyridinyl)-(4-chloro-1-ethylpyrazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114660511 |
| Molecular Formula | C13H16BrClN4 |
| Molecular Weight | 343.66 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)-(4-chloro-1-ethylpyrazol-5-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Br)cn1)c1c(Cl)cnn1CC |
| InChI | InChI=1S/C13H16BrClN4/c1-3-16-12(11-6-5-9(14)7-17-11)13-10(15)8-18-19(13)4-2/h5-8,12,16H,3-4H2,1-2H3 |
| InChIKey | XDPWGJACNPYBTC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |