C15H24BrN3 — CID 114660904
N-[1-(4-bromo-1-methylpyrazol-5-yl)-2-(cyclohexen-1-yl)ethyl]propan-1-amine (PubChem CID 114660904) has the molecular formula C15H24BrN3 and a molecular weight of 326.28 g/mol. Its IUPAC name is N-[1-(4-bromo-1-methylpyrazol-5-yl)-2-(cyclohexen-1-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-bromo-1-methylpyrazol-5-yl)-2-(cyclohexen-1-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 114660904 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[1-(4-bromo-1-methylpyrazol-5-yl)-2-(cyclohexen-1-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1=CCCCC1)c1c(Br)cnn1C |
| InChI | InChI=1S/C15H24BrN3/c1-3-9-17-14(10-12-7-5-4-6-8-12)15-13(16)11-18-19(15)2/h7,11,14,17H,3-6,8-10H2,1-2H3 |
| InChIKey | SASGHJWJTAIUCZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|