C27H38O3S2Si — CID 11466208
tert-butyl-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethoxy]-diphenylsilane (PubChem CID 11466208) has the molecular formula C27H38O3S2Si and a molecular weight of 502.82 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11466208 |
| Molecular Formula | C27H38O3S2Si |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | tert-butyl-[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)ethoxy]-diphenylsilane |
| SMILES | CC1(C)OC[C@@H]([C@@H](CC2SCCCS2)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H38O3S2Si/c1-26(2,3)33(21-13-8-6-9-14-21,22-15-10-7-11-16-22)30-23(19-25-31-17-12-18-32-25)24-20-28-27(4,5)29-24/h6-11,13-16,23-25H,12,17-20H2,1-5H3/t23-,24+/m1/s1 |
| InChIKey | NTHNSOAJHLACHU-RPWUZVMVSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|