C26H24N2O9 — CID 11466320
3-[[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]amino]-1-methylpyrrole-2,5-dione (PubChem CID 11466320) has the molecular formula C26H24N2O9 and a molecular weight of 508.48 g/mol. Its IUPAC name is 3-[[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]amino]-1-methylpyrrole-2,5-dione.
| Compound Name | 3-[[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]amino]-1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 11466320 |
| Molecular Formula | C26H24N2O9 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 3-[[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]amino]-1-methylpyrrole-2,5-dione |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC3=CC(=O)N(C)C3=O)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C26H24N2O9/c1-28-20(29)8-15(25(28)31)27-23-13-7-17-16(36-10-37-17)6-12(13)21(22-14(23)9-35-26(22)32)11-4-18(33-2)24(30)19(5-11)34-3/h4-8,14,21-23,27,30H,9-10H2,1-3H3/t14-,21+,22-,23+/m0/s1 |
| InChIKey | UJUMWQMKABSAID-UIJCFEMGSA-N |
| XLogP | 1.59 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|