C25H48O10 — CID 11466329
[(3S,5R,8R,9R,11R)-9,11-dihydroxy-3,5,8-tris(methoxymethoxy)tetradec-13-enyl] 2,2-dimethylpropanoate (PubChem CID 11466329) has the molecular formula C25H48O10 and a molecular weight of 508.65 g/mol. Its IUPAC name is [(3S,5R,8R,9R,11R)-9,11-dihydroxy-3,5,8-tris(methoxymethoxy)tetradec-13-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,5R,8R,9R,11R)-9,11-dihydroxy-3,5,8-tris(methoxymethoxy)tetradec-13-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11466329 |
| Molecular Formula | C25H48O10 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | [(3S,5R,8R,9R,11R)-9,11-dihydroxy-3,5,8-tris(methoxymethoxy)tetradec-13-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H](O)C[C@@H](O)[C@@H](CC[C@H](C[C@H](CCOC(=O)C(C)(C)C)OCOC)OCOC)OCOC |
| InChI | InChI=1S/C25H48O10/c1-8-9-19(26)14-22(27)23(35-18-31-7)11-10-20(33-16-29-5)15-21(34-17-30-6)12-13-32-24(28)25(2,3)4/h8,19-23,26-27H,1,9-18H2,2-7H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | KTKVMJCIMLEDHD-XNBWIAOKSA-N |
| XLogP | 2.79 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|