C12H21ClN2O — CID 114665007
1-(4-chloro-1-ethylpyrazol-5-yl)-4,4-dimethylpentan-3-ol (PubChem CID 114665007) has the molecular formula C12H21ClN2O and a molecular weight of 244.77 g/mol. Its IUPAC name is 1-(4-chloro-1-ethylpyrazol-5-yl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 114665007 |
| Molecular Formula | C12H21ClN2O |
| Molecular Weight | 244.77 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-(4-chloro-1-ethylpyrazol-5-yl)-4,4-dimethylpentan-3-ol |
| SMILES | CCn1ncc(Cl)c1CCC(O)C(C)(C)C |
| InChI | InChI=1S/C12H21ClN2O/c1-5-15-10(9(13)8-14-15)6-7-11(16)12(2,3)4/h8,11,16H,5-7H2,1-4H3 |
| InChIKey | IHTZWRDMJFIBOF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |