C12H19Br2N3 — CID 114665381
2-[4-bromo-5-(3-bromocyclopentyl)pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 114665381) has the molecular formula C12H19Br2N3 and a molecular weight of 365.11 g/mol. Its IUPAC name is 2-[4-bromo-5-(3-bromocyclopentyl)pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-bromo-5-(3-bromocyclopentyl)pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 114665381 |
| Molecular Formula | C12H19Br2N3 |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2-[4-bromo-5-(3-bromocyclopentyl)pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Br)c1C1CCC(Br)C1 |
| InChI | InChI=1S/C12H19Br2N3/c1-16(2)5-6-17-12(11(14)8-15-17)9-3-4-10(13)7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | ZCWLLJKNUKCKRU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|