C9H16ClN3O — CID 114665843
1-(4-chloro-1-methylpyrazol-5-yl)-2-(propan-2-ylamino)ethanol (PubChem CID 114665843) has the molecular formula C9H16ClN3O and a molecular weight of 217.70 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2-(propan-2-ylamino)ethanol.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(propan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 114665843 |
| Molecular Formula | C9H16ClN3O |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(propan-2-ylamino)ethanol |
| SMILES | CC(C)NCC(O)c1c(Cl)cnn1C |
| InChI | InChI=1S/C9H16ClN3O/c1-6(2)11-5-8(14)9-7(10)4-12-13(9)3/h4,6,8,11,14H,5H2,1-3H3 |
| InChIKey | UZZCPMZKWJOLEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |