C33H33ClN2O2 — CID 11466628
[(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate chloride (PubChem CID 11466628) has the molecular formula C33H33ClN2O2 and a molecular weight of 525.09 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate chloride.
| Compound Name | [(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate chloride |
|---|---|
| PubChem CID | 11466628 |
| Molecular Formula | C33H33ClN2O2 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [(R)-[(2S,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate chloride |
| SMILES | C=C[C@H]1C[N+]2(Cc3ccccc3)CC[C@H]1C[C@H]2[C@H](OC(=O)c1ccccc1)c1ccnc2ccccc12.[Cl-] |
| InChI | InChI=1S/C33H33N2O2.ClH/c1-2-25-23-35(22-24-11-5-3-6-12-24)20-18-27(25)21-31(35)32(37-33(36)26-13-7-4-8-14-26)29-17-19-34-30-16-10-9-15-28(29)30;/h2-17,19,25,27,31-32H,1,18,20-23H2;1H/q+1;/p-1/t25-,27-,31-,32+,35?;/m0./s1 |
| InChIKey | PPWDRJOTXZGBQS-ZQQWPMRGSA-M |
| XLogP | 3.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|