C15H26BrN3 — CID 114666338
(Z)-4-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-(2-methylpropyl)pent-3-en-1-amine (PubChem CID 114666338) has the molecular formula C15H26BrN3 and a molecular weight of 328.30 g/mol. Its IUPAC name is (Z)-4-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-(2-methylpropyl)pent-3-en-1-amine.
| Compound Name | (Z)-4-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-(2-methylpropyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 114666338 |
| Molecular Formula | C15H26BrN3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (Z)-4-(4-bromo-1-propan-2-ylpyrazol-5-yl)-N-(2-methylpropyl)pent-3-en-1-amine |
| SMILES | C/C(=C/CCNCC(C)C)c1c(Br)cnn1C(C)C |
| InChI | InChI=1S/C15H26BrN3/c1-11(2)9-17-8-6-7-13(5)15-14(16)10-18-19(15)12(3)4/h7,10-12,17H,6,8-9H2,1-5H3/b13-7- |
| InChIKey | FNJIWSFTIXEDPH-QPEQYQDCSA-N |
| XLogP | 4.27 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|