C15H27N3O — CID 114667107
N-[[2-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclopentyl]methyl]ethanamine (PubChem CID 114667107) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is N-[[2-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclopentyl]methyl]ethanamine.
| Compound Name | N-[[2-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclopentyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114667107 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | N-[[2-(4-methoxy-1-propan-2-ylpyrazol-5-yl)cyclopentyl]methyl]ethanamine |
| SMILES | CCNCC1CCCC1c1c(OC)cnn1C(C)C |
| InChI | InChI=1S/C15H27N3O/c1-5-16-9-12-7-6-8-13(12)15-14(19-4)10-17-18(15)11(2)3/h10-13,16H,5-9H2,1-4H3 |
| InChIKey | GXPJVNBRAQGHSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |