C13H5F17O3 — CID 11466742
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)oxane-2,6-dione (PubChem CID 11466742) has the molecular formula C13H5F17O3 and a molecular weight of 532.15 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)oxane-2,6-dione.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)oxane-2,6-dione |
|---|---|
| PubChem CID | 11466742 |
| Molecular Formula | C13H5F17O3 |
| Molecular Weight | 532.15 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)oxane-2,6-dione |
| SMILES | O=C1CC(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O1 |
| InChI | InChI=1S/C13H5F17O3/c14-6(15,3-1-4(31)33-5(32)2-3)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h3H,1-2H2 |
| InChIKey | OGWAXUVUTOMELV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.15 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|