C17H28ClN3 — CID 114667437
N-[[2-(4-chloro-1-propylpyrazol-5-yl)-4-methylcyclohexyl]methyl]cyclopropanamine (PubChem CID 114667437) has the molecular formula C17H28ClN3 and a molecular weight of 309.89 g/mol. Its IUPAC name is N-[[2-(4-chloro-1-propylpyrazol-5-yl)-4-methylcyclohexyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(4-chloro-1-propylpyrazol-5-yl)-4-methylcyclohexyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114667437 |
| Molecular Formula | C17H28ClN3 |
| Molecular Weight | 309.89 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[[2-(4-chloro-1-propylpyrazol-5-yl)-4-methylcyclohexyl]methyl]cyclopropanamine |
| SMILES | CCCn1ncc(Cl)c1C1CC(C)CCC1CNC1CC1 |
| InChI | InChI=1S/C17H28ClN3/c1-3-8-21-17(16(18)11-20-21)15-9-12(2)4-5-13(15)10-19-14-6-7-14/h11-15,19H,3-10H2,1-2H3 |
| InChIKey | FGXRFMGEGLITFC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |