C31H54O5Si — CID 11466773
(1S,3E,7E,11S,12E,15S,16R,17R,20S,21R)-11-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-triene-16,20,21-triol (PubChem CID 11466773) has the molecular formula C31H54O5Si and a molecular weight of 534.85 g/mol. Its IUPAC name is (1S,3E,7E,11S,12E,15S,16R,17R,20S,21R)-11-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-triene-16,20,21-triol.
| Compound Name | (1S,3E,7E,11S,12E,15S,16R,17R,20S,21R)-11-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-triene-16,20,21-triol |
|---|---|
| PubChem CID | 11466773 |
| Molecular Formula | C31H54O5Si |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | (1S,3E,7E,11S,12E,15S,16R,17R,20S,21R)-11-[tert-butyl(dimethyl)silyl]oxy-1,4,8,12,17-pentamethyl-19-oxatricyclo[13.6.0.016,20]henicosa-3,7,12-triene-16,20,21-triol |
| SMILES | C/C1=C\C[C@]2(C)[C@@H](O)[C@]3(O)OC[C@@H](C)[C@]3(O)[C@H]2C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C31H54O5Si/c1-21-12-11-13-22(2)18-19-29(8)26(30(33)24(4)20-35-31(30,34)27(29)32)17-15-23(3)25(16-14-21)36-37(9,10)28(5,6)7/h12,15,18,24-27,32-34H,11,13-14,16-17,19-20H2,1-10H3/b21-12+,22-18+,23-15+/t24-,25+,26+,27-,29+,30+,31+/m1/s1 |
| InChIKey | PZTVGJGRLQGBSK-XYAJNPIZSA-N |
| XLogP | 6.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|