About 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine
2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine (PubChem CID 114667850) has the molecular formula C10H17BrFN3
and a molecular weight of 278.17 g/mol. Its IUPAC name is 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine |
| PubChem CID | 114667850 |
| Molecular Formula | C10H17BrFN3 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine |
| SMILES | Cn1ncc(Br)c1C(F)(CN)C(C)(C)C |
| InChI | InChI=1S/C10H17BrFN3/c1-9(2,3)10(12,6-13)8-7(11)5-14-15(8)4/h5H,6,13H2,1-4H3 |
| InChIKey | IZYUUJPECXYIQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine?
The IUPAC name of 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine (CID 114667850) is 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine.
What is the SMILES notation for 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine?
The canonical SMILES for 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine is Cn1ncc(Br)c1C(F)(CN)C(C)(C)C.
What is the InChIKey of 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine?
The InChIKey is IZYUUJPECXYIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrFN3/c1-9(2,3)10(12,6-13)8-7(11)5-14-15(8)4/h5H,6,13H2,1-4H3.
What are the key properties of 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine?
2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine has a molecular weight of 278.17 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-1-methylpyrazol-5-yl)-2-fluoro-3,3-dimethylbutan-1-amine is sourced from PubChem (CID 114667850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).