C30H40F2O5S — CID 11466987
[(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-1-(benzenesulfonyl)-1,1-difluoro-2-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 11466987) has the molecular formula C30H40F2O5S and a molecular weight of 550.71 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-1-(benzenesulfonyl)-1,1-difluoro-2-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-1-(benzenesulfonyl)-1,1-difluoro-2-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 11466987 |
| Molecular Formula | C30H40F2O5S |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | [(3S,8S,9S,10R,13S,14S,17S)-17-[(2R)-1-(benzenesulfonyl)-1,1-difluoro-2-hydroxypropan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@@](C)(O)C(F)(F)S(=O)(=O)c5ccccc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H40F2O5S/c1-19(33)37-21-14-16-27(2)20(18-21)10-11-23-24-12-13-26(28(24,3)17-15-25(23)27)29(4,34)30(31,32)38(35,36)22-8-6-5-7-9-22/h5-10,21,23-26,34H,11-18H2,1-4H3/t21-,23-,24-,25-,26-,27-,28-,29+/m0/s1 |
| InChIKey | APTZQJCQIVYESB-HOIKMHIUSA-N |
| XLogP | 6.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|