C24H45IO4Si — CID 11467009
2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol (PubChem CID 11467009) has the molecular formula C24H45IO4Si and a molecular weight of 552.61 g/mol. Its IUPAC name is 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol.
| Compound Name | 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol |
|---|---|
| PubChem CID | 11467009 |
| Molecular Formula | C24H45IO4Si |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 2-[(2R,3S,6R,8S,11R)-11-iodo-3-methyl-2-[3-tri(propan-2-yl)silyloxypropyl]-1,7-dioxaspiro[5.5]undec-4-en-8-yl]ethanol |
| SMILES | CC(C)[Si](OCCC[C@H]1O[C@@]2(C=C[C@@H]1C)O[C@H](CCO)CC[C@H]2I)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H45IO4Si/c1-17(2)30(18(3)4,19(5)6)27-16-8-9-22-20(7)12-14-24(29-22)23(25)11-10-21(28-24)13-15-26/h12,14,17-23,26H,8-11,13,15-16H2,1-7H3/t20-,21-,22+,23+,24+/m0/s1 |
| InChIKey | NGRUWVANVSZVHH-QJUOVVKFSA-N |
| XLogP | 6.61 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|