About 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one
3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 114671419) has the molecular formula C15H15F3O2
and a molecular weight of 284.28 g/mol. Its IUPAC name is 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| PubChem CID | 114671419 |
| Molecular Formula | C15H15F3O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | O=C1CC2(CCCC(C(F)(F)F)C2)Oc2ccccc21 |
| InChI | InChI=1S/C15H15F3O2/c16-15(17,18)10-4-3-7-14(8-10)9-12(19)11-5-1-2-6-13(11)20-14/h1-2,5-6,10H,3-4,7-9H2 |
| InChIKey | DAFKIMRXSXVQIL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The IUPAC name of 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one (CID 114671419) is 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The canonical SMILES for 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one is O=C1CC2(CCCC(C(F)(F)F)C2)Oc2ccccc21.
What is the InChIKey of 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The InChIKey is DAFKIMRXSXVQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3O2/c16-15(17,18)10-4-3-7-14(8-10)9-12(19)11-5-1-2-6-13(11)20-14/h1-2,5-6,10H,3-4,7-9H2.
What are the key properties of 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one has a molecular weight of 284.28 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(trifluoromethyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 114671419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).