About 2-cyclopropyl-2,3-dihydrochromen-4-one
2-cyclopropyl-2,3-dihydrochromen-4-one (PubChem CID 114671469) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-cyclopropyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-2,3-dihydrochromen-4-one |
| PubChem CID | 114671469 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-cyclopropyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(C2CC2)Oc2ccccc21 |
| InChI | InChI=1S/C12H12O2/c13-10-7-12(8-5-6-8)14-11-4-2-1-3-9(10)11/h1-4,8,12H,5-7H2 |
| InChIKey | SUKUANLWBKMUBG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-cyclopropyl-2,3-dihydrochromen-4-one (CID 114671469) is 2-cyclopropyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-cyclopropyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-cyclopropyl-2,3-dihydrochromen-4-one is O=C1CC(C2CC2)Oc2ccccc21.
What is the InChIKey of 2-cyclopropyl-2,3-dihydrochromen-4-one?
The InChIKey is SUKUANLWBKMUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c13-10-7-12(8-5-6-8)14-11-4-2-1-3-9(10)11/h1-4,8,12H,5-7H2.
What are the key properties of 2-cyclopropyl-2,3-dihydrochromen-4-one?
2-cyclopropyl-2,3-dihydrochromen-4-one has a molecular weight of 188.23 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 114671469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).