C31H38N4O6 — CID 11467150
methyl 4-decoxy-6-[[6-(phenylmethoxycarbonylamino)-2-pyridinyl]carbamoyl]pyridine-2-carboxylate (PubChem CID 11467150) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is methyl 4-decoxy-6-[[6-(phenylmethoxycarbonylamino)-2-pyridinyl]carbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-decoxy-6-[[6-(phenylmethoxycarbonylamino)-2-pyridinyl]carbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11467150 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | methyl 4-decoxy-6-[[6-(phenylmethoxycarbonylamino)-2-pyridinyl]carbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCCCCCCCOc1cc(C(=O)Nc2cccc(NC(=O)OCc3ccccc3)n2)nc(C(=O)OC)c1 |
| InChI | InChI=1S/C31H38N4O6/c1-3-4-5-6-7-8-9-13-19-40-24-20-25(32-26(21-24)30(37)39-2)29(36)34-27-17-14-18-28(33-27)35-31(38)41-22-23-15-11-10-12-16-23/h10-12,14-18,20-21H,3-9,13,19,22H2,1-2H3,(H2,33,34,35,36,38) |
| InChIKey | ZFFLCFLUDTVOIR-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|