About 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one
1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one (PubChem CID 114672071) has the molecular formula C16H18FNO2
and a molecular weight of 275.32 g/mol. Its IUPAC name is 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one.
Molecular Properties
| Compound Name | 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one |
| PubChem CID | 114672071 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one |
| SMILES | CC1CC2(CC(=O)c3cc(F)ccc3O2)CN1C1CC1 |
| InChI | InChI=1S/C16H18FNO2/c1-10-7-16(9-18(10)12-3-4-12)8-14(19)13-6-11(17)2-5-15(13)20-16/h2,5-6,10,12H,3-4,7-9H2,1H3 |
| InChIKey | IFJGKRXHSKJKDL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one?
The IUPAC name of 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one (CID 114672071) is 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one.
What is the SMILES notation for 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one?
The canonical SMILES for 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one is CC1CC2(CC(=O)c3cc(F)ccc3O2)CN1C1CC1.
What is the InChIKey of 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one?
The InChIKey is IFJGKRXHSKJKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO2/c1-10-7-16(9-18(10)12-3-4-12)8-14(19)13-6-11(17)2-5-15(13)20-16/h2,5-6,10,12H,3-4,7-9H2,1H3.
What are the key properties of 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one?
1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one has a molecular weight of 275.32 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-cyclopropyl-6-fluoro-2'-methylspiro[3H-chromene-2,4'-pyrrolidine]-4-one is sourced from PubChem (CID 114672071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).