About 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one
6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one (PubChem CID 114673000) has the molecular formula C14H17ClO2
and a molecular weight of 252.74 g/mol. Its IUPAC name is 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 114673000 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(C)(C)CC1CC(=O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C14H17ClO2/c1-14(2,3)8-10-7-12(16)11-6-9(15)4-5-13(11)17-10/h4-6,10H,7-8H2,1-3H3 |
| InChIKey | FHDFYVAOCDJPAP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one (CID 114673000) is 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one is CC(C)(C)CC1CC(=O)c2cc(Cl)ccc2O1.
What is the InChIKey of 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one?
The InChIKey is FHDFYVAOCDJPAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO2/c1-14(2,3)8-10-7-12(16)11-6-9(15)4-5-13(11)17-10/h4-6,10H,7-8H2,1-3H3.
What are the key properties of 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one?
6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one has a molecular weight of 252.74 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(2,2-dimethylpropyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 114673000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).