C39H40N4O — CID 11467331
10-methoxy-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin (PubChem CID 11467331) has the molecular formula C39H40N4O and a molecular weight of 580.78 g/mol. Its IUPAC name is 10-methoxy-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 10-methoxy-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 11467331 |
| Molecular Formula | C39H40N4O |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 10-methoxy-3,3,13,13-tetramethyl-7,17-bis(4-methylphenyl)-2,12,22,24-tetrahydroporphyrin |
| SMILES | COc1c2nc(cc3[nH]c(cc4nc(cc5[nH]c1cc5-c1ccc(C)cc1)C(C)(C)C4)cc3-c1ccc(C)cc1)C(C)(C)C2 |
| InChI | InChI=1S/C39H40N4O/c1-23-8-12-25(13-9-23)29-17-27-16-28-21-38(3,4)35(41-28)20-32-30(26-14-10-24(2)11-15-26)18-33(42-32)37(44-7)34-22-39(5,6)36(43-34)19-31(29)40-27/h8-20,40,42H,21-22H2,1-7H3/b27-16-,28-16-,31-19-,32-20-,35-20-,36-19-,37-33+,37-34+ |
| InChIKey | ALDWNPJHZFCIHC-CJHFGKTJSA-N |
| XLogP | 9.31 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |