C27H57N3 — CID 11467348
1,3,5-tris(2-ethylhexyl)-1,3,5-triazinane (PubChem CID 11467348) has the molecular formula C27H57N3 and a molecular weight of 423.77 g/mol. Its IUPAC name is 1,3,5-tris(2-ethylhexyl)-1,3,5-triazinane.
| Compound Name | 1,3,5-tris(2-ethylhexyl)-1,3,5-triazinane |
|---|---|
| PubChem CID | 11467348 |
| Molecular Formula | C27H57N3 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 423.46 |
| IUPAC Name | 1,3,5-tris(2-ethylhexyl)-1,3,5-triazinane |
| SMILES | CCCCC(CC)CN1CN(CC(CC)CCCC)CN(CC(CC)CCCC)C1 |
| InChI | InChI=1S/C27H57N3/c1-7-13-16-25(10-4)19-28-22-29(20-26(11-5)17-14-8-2)24-30(23-28)21-27(12-6)18-15-9-3/h25-27H,7-24H2,1-6H3 |
| InChIKey | IOOQZUUFSICDQX-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |