C24H46Br2O2Si2 — CID 11467352
tert-butyl-[(3E,5E,7R,8R)-10,10-dibromo-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldeca-3,5,9-trienoxy]-dimethylsilane (PubChem CID 11467352) has the molecular formula C24H46Br2O2Si2 and a molecular weight of 582.61 g/mol. Its IUPAC name is tert-butyl-[(3E,5E,7R,8R)-10,10-dibromo-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldeca-3,5,9-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5E,7R,8R)-10,10-dibromo-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldeca-3,5,9-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11467352 |
| Molecular Formula | C24H46Br2O2Si2 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | tert-butyl-[(3E,5E,7R,8R)-10,10-dibromo-7-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyldeca-3,5,9-trienoxy]-dimethylsilane |
| SMILES | CC(/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=C(Br)Br)=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46Br2O2Si2/c1-19(14-13-17-27-29(9,10)23(3,4)5)15-16-21(20(2)18-22(25)26)28-30(11,12)24(6,7)8/h14-16,18,20-21H,13,17H2,1-12H3/b16-15+,19-14+/t20-,21-/m1/s1 |
| InChIKey | JHEAOBHAVVJMIE-HKSWRZQQSA-N |
| XLogP | 9.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|