C13H8BrF3N2O2 — CID 114673566
4-(5-bromo-2-fluorophenoxy)-3,5-difluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 114673566) has the molecular formula C13H8BrF3N2O2 and a molecular weight of 361.12 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenoxy)-3,5-difluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(5-bromo-2-fluorophenoxy)-3,5-difluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114673566 |
| Molecular Formula | C13H8BrF3N2O2 |
| Molecular Weight | 361.12 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | 4-(5-bromo-2-fluorophenoxy)-3,5-difluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1cc(F)c(Oc2cc(Br)ccc2F)c(F)c1 |
| InChI | InChI=1S/C13H8BrF3N2O2/c14-7-1-2-8(15)11(5-7)21-12-9(16)3-6(4-10(12)17)13(18)19-20/h1-5,20H,(H2,18,19) |
| InChIKey | ZFQXEHJIDBQAME-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|