C31H26BrN3O2S — CID 11467372
4-[[1-(benzenesulfonyl)-3-[(E)-2-(4-bromophenyl)ethenyl]indol-2-yl]methylideneamino]-N,N-dimethylaniline (PubChem CID 11467372) has the molecular formula C31H26BrN3O2S and a molecular weight of 584.54 g/mol. Its IUPAC name is 4-[[1-(benzenesulfonyl)-3-[(E)-2-(4-bromophenyl)ethenyl]indol-2-yl]methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(benzenesulfonyl)-3-[(E)-2-(4-bromophenyl)ethenyl]indol-2-yl]methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11467372 |
| Molecular Formula | C31H26BrN3O2S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | 4-[[1-(benzenesulfonyl)-3-[(E)-2-(4-bromophenyl)ethenyl]indol-2-yl]methylideneamino]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=C/c2c(/C=C/c3ccc(Br)cc3)c3ccccc3n2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H26BrN3O2S/c1-34(2)26-19-17-25(18-20-26)33-22-31-29(21-14-23-12-15-24(32)16-13-23)28-10-6-7-11-30(28)35(31)38(36,37)27-8-4-3-5-9-27/h3-22H,1-2H3/b21-14+,33-22+ |
| InChIKey | QJMCRGSVKXLREM-PRPKHJJJSA-N |
| XLogP | 7.63 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|