C15H11FO3 — CID 114674580
7-fluoro-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 114674580) has the molecular formula C15H11FO3 and a molecular weight of 258.25 g/mol. Its IUPAC name is 7-fluoro-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 7-fluoro-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 114674580 |
| Molecular Formula | C15H11FO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 7-fluoro-2-(3-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | O=C1CC(c2cccc(O)c2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C15H11FO3/c16-10-4-5-12-13(18)8-14(19-15(12)7-10)9-2-1-3-11(17)6-9/h1-7,14,17H,8H2 |
| InChIKey | NFKXTOCYGPOLQY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |