C15H16BFO3 — CID 114674618
[3-[(3,4-dimethylphenyl)methoxy]-4-fluorophenyl]boronic acid (PubChem CID 114674618) has the molecular formula C15H16BFO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is [3-[(3,4-dimethylphenyl)methoxy]-4-fluorophenyl]boronic acid.
| Compound Name | [3-[(3,4-dimethylphenyl)methoxy]-4-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 114674618 |
| Molecular Formula | C15H16BFO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [3-[(3,4-dimethylphenyl)methoxy]-4-fluorophenyl]boronic acid |
| SMILES | Cc1ccc(COc2cc(B(O)O)ccc2F)cc1C |
| InChI | InChI=1S/C15H16BFO3/c1-10-3-4-12(7-11(10)2)9-20-15-8-13(16(18)19)5-6-14(15)17/h3-8,18-19H,9H2,1-2H3 |
| InChIKey | YKFLRXQBIOISTK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|