C12H12BF4N2O- — CID 114675060
[3-[(2,5-dimethylpyrazol-3-yl)methoxy]-4-fluorophenyl]-trifluoroboranuide (PubChem CID 114675060) has the molecular formula C12H12BF4N2O- and a molecular weight of 287.05 g/mol. Its IUPAC name is [3-[(2,5-dimethylpyrazol-3-yl)methoxy]-4-fluorophenyl]-trifluoroboranuide.
| Compound Name | [3-[(2,5-dimethylpyrazol-3-yl)methoxy]-4-fluorophenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 114675060 |
| Molecular Formula | C12H12BF4N2O- |
| Molecular Weight | 287.05 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [3-[(2,5-dimethylpyrazol-3-yl)methoxy]-4-fluorophenyl]-trifluoroboranuide |
| SMILES | Cc1cc(COc2cc([B-](F)(F)F)ccc2F)n(C)n1 |
| InChI | InChI=1S/C12H12BF4N2O/c1-8-5-10(19(2)18-8)7-20-12-6-9(13(15,16)17)3-4-11(12)14/h3-6H,7H2,1-2H3/q-1 |
| InChIKey | RWRPFSQKTVGHEX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.05 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|