C36H56O4Si2 — CID 11467596
tert-butyl-[(3R,4R)-5-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-4-methyl-3-triethylsilyloxypentoxy]-diphenylsilane (PubChem CID 11467596) has the molecular formula C36H56O4Si2 and a molecular weight of 609.01 g/mol. Its IUPAC name is tert-butyl-[(3R,4R)-5-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-4-methyl-3-triethylsilyloxypentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(3R,4R)-5-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-4-methyl-3-triethylsilyloxypentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11467596 |
| Molecular Formula | C36H56O4Si2 |
| Molecular Weight | 609.01 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | tert-butyl-[(3R,4R)-5-(1,10-dioxaspiro[4.5]dec-6-en-2-yl)-4-methyl-3-triethylsilyloxypentoxy]-diphenylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C)CC1CCC2(C=CCCO2)O1 |
| InChI | InChI=1S/C36H56O4Si2/c1-8-41(9-2,10-3)40-34(30(4)29-31-23-26-36(39-31)25-17-18-27-37-36)24-28-38-42(35(5,6)7,32-19-13-11-14-20-32)33-21-15-12-16-22-33/h11-17,19-22,25,30-31,34H,8-10,18,23-24,26-29H2,1-7H3/t30-,31?,34-,36?/m1/s1 |
| InChIKey | VGEKCNAPVHFISJ-NSYQOPEJSA-N |
| XLogP | 8.22 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.01 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|