C7H5ClF4N2O2 — CID 114676156
5-chloro-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 114676156) has the molecular formula C7H5ClF4N2O2 and a molecular weight of 260.57 g/mol. Its IUPAC name is 5-chloro-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676156 |
| Molecular Formula | C7H5ClF4N2O2 |
| Molecular Weight | 260.57 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 5-chloro-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCC(F)(F)C(F)F)c1Cl |
| InChI | InChI=1S/C7H5ClF4N2O2/c8-3-4(15)13-2-14-5(3)16-1-7(11,12)6(9)10/h2,6H,1H2,(H,13,14,15) |
| InChIKey | RHSUEVCCNRLGOU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|