C7H5F4IN2O2 — CID 114676157
5-iodo-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 114676157) has the molecular formula C7H5F4IN2O2 and a molecular weight of 352.03 g/mol. Its IUPAC name is 5-iodo-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114676157 |
| Molecular Formula | C7H5F4IN2O2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 5-iodo-4-(2,2,3,3-tetrafluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCC(F)(F)C(F)F)c1I |
| InChI | InChI=1S/C7H5F4IN2O2/c8-6(9)7(10,11)1-16-5-3(12)4(15)13-2-14-5/h2,6H,1H2,(H,13,14,15) |
| InChIKey | BSBZKCILCMWAAV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|