About 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one
5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 114676563) has the molecular formula C7H6F3IN2O2
and a molecular weight of 334.04 g/mol. Its IUPAC name is 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one |
| PubChem CID | 114676563 |
| Molecular Formula | C7H6F3IN2O2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCCC(F)(F)F)c1I |
| InChI | InChI=1S/C7H6F3IN2O2/c8-7(9,10)1-2-15-6-4(11)5(14)12-3-13-6/h3H,1-2H2,(H,12,13,14) |
| InChIKey | SCKONTYAXRKXOF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one?
The IUPAC name of 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one (CID 114676563) is 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one?
The canonical SMILES for 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one is O=c1[nH]cnc(OCCC(F)(F)F)c1I.
What is the InChIKey of 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one?
The InChIKey is SCKONTYAXRKXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3IN2O2/c8-7(9,10)1-2-15-6-4(11)5(14)12-3-13-6/h3H,1-2H2,(H,12,13,14).
What are the key properties of 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one?
5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one has a molecular weight of 334.04 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one is sourced from PubChem (CID 114676563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).