C11H17N3O — CID 114677796
1-(2-amino-3-pyridinyl)-3-methylpiperidin-4-ol (PubChem CID 114677796) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-3-methylpiperidin-4-ol.
| Compound Name | 1-(2-amino-3-pyridinyl)-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 114677796 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-3-methylpiperidin-4-ol |
| SMILES | CC1CN(c2cccnc2N)CCC1O |
| InChI | InChI=1S/C11H17N3O/c1-8-7-14(6-4-10(8)15)9-3-2-5-13-11(9)12/h2-3,5,8,10,15H,4,6-7H2,1H3,(H2,12,13) |
| InChIKey | UXYLIWIZVKOKEU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |