About 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide
4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide (PubChem CID 114679011) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide |
| PubChem CID | 114679011 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCC(O)C(C)C1 |
| InChI | InChI=1S/C8H17N3O/c1-6-5-11(8(9)10-2)4-3-7(6)12/h6-7,12H,3-5H2,1-2H3,(H2,9,10) |
| InChIKey | VVXGQYJZOOPNOY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide?
The IUPAC name of 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide (CID 114679011) is 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide.
What is the SMILES notation for 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide?
The canonical SMILES for 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide is C/N=C(\N)N1CCC(O)C(C)C1.
What is the InChIKey of 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide?
The InChIKey is VVXGQYJZOOPNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-6-5-11(8(9)10-2)4-3-7(6)12/h6-7,12H,3-5H2,1-2H3,(H2,9,10).
What are the key properties of 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide?
4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide has a molecular weight of 171.24 g/mol, XLogP of -0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N',3-dimethylpiperidine-1-carboximidamide is sourced from PubChem (CID 114679011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).