C14H18ClFN2O2 — CID 114681562
N-(2-chloro-4-fluorophenyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide (PubChem CID 114681562) has the molecular formula C14H18ClFN2O2 and a molecular weight of 300.76 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 114681562 |
| Molecular Formula | C14H18ClFN2O2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-(4-hydroxy-3-methylpiperidin-1-yl)acetamide |
| SMILES | CC1CN(CC(=O)Nc2ccc(F)cc2Cl)CCC1O |
| InChI | InChI=1S/C14H18ClFN2O2/c1-9-7-18(5-4-13(9)19)8-14(20)17-12-3-2-10(16)6-11(12)15/h2-3,6,9,13,19H,4-5,7-8H2,1H3,(H,17,20) |
| InChIKey | UVFSDHRQZZVNCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |