About 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline
2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline (PubChem CID 11468208) has the molecular formula C18H9Br6N
and a molecular weight of 718.70 g/mol. Its IUPAC name is 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline.
Molecular Properties
| Compound Name | 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline |
| PubChem CID | 11468208 |
| Molecular Formula | C18H9Br6N |
| Molecular Weight | 718.70 g/mol |
| Exact Mass | 712.58 |
| IUPAC Name | 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2Br)c2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C18H9Br6N/c19-10-1-4-16(13(22)7-10)25(17-5-2-11(20)8-14(17)23)18-6-3-12(21)9-15(18)24/h1-9H |
| InChIKey | KLOKRJIOLRCMRK-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 718.70 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline?
The IUPAC name of 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline (CID 11468208) is 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline.
What is the SMILES notation for 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline?
The canonical SMILES for 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline is Brc1ccc(N(c2ccc(Br)cc2Br)c2ccc(Br)cc2Br)c(Br)c1.
What is the InChIKey of 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline?
The InChIKey is KLOKRJIOLRCMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9Br6N/c19-10-1-4-16(13(22)7-10)25(17-5-2-11(20)8-14(17)23)18-6-3-12(21)9-15(18)24/h1-9H.
What are the key properties of 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline?
2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline has a molecular weight of 718.70 g/mol, XLogP of 9.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-N,N-bis(2,4-dibromophenyl)aniline is sourced from PubChem (CID 11468208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).