C38H76O7Si3 — CID 11468249
prop-2-enyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate (PubChem CID 11468249) has the molecular formula C38H76O7Si3 and a molecular weight of 729.28 g/mol. Its IUPAC name is prop-2-enyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate.
| Compound Name | prop-2-enyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
|---|---|
| PubChem CID | 11468249 |
| Molecular Formula | C38H76O7Si3 |
| Molecular Weight | 729.28 g/mol |
| Exact Mass | 728.49 |
| IUPAC Name | prop-2-enyl (E,2R,3S,4S,5R,6S,7R,10S)-2,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4,6,8,10-tetramethyl-11-oxo-5-triethylsilyloxydodec-8-enoate |
| SMILES | C=CCOC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](C)C(C)=O |
| InChI | InChI=1S/C38H76O7Si3/c1-21-25-42-36(40)35(44-47(19,20)38(13,14)15)34(41-16)30(8)33(45-48(22-2,23-3)24-4)29(7)32(28(6)26-27(5)31(9)39)43-46(17,18)37(10,11)12/h21,26-27,29-30,32-35H,1,22-25H2,2-20H3/b28-26+/t27-,29+,30+,32-,33-,34-,35+/m0/s1 |
| InChIKey | KOJXPLKWYDVYHE-GZSLTMFWSA-N |
| XLogP | 10.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.28 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|