C41H66O11Si — CID 11468364
CID 11468364 (PubChem CID 11468364) has the molecular formula C41H66O11Si and a molecular weight of 763.05 g/mol.
| Compound Name | CID 11468364 |
|---|---|
| PubChem CID | 11468364 |
| Molecular Formula | C41H66O11Si |
| Molecular Weight | 763.05 g/mol |
| Exact Mass | 762.44 |
| IUPAC Name | — |
| SMILES | C=C(COC(C)=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C(=O)[C@H](O)[C@@H]1C[C@H]2O[C@@]3(CC[C@]4(CC=C[C@@H](/C=C/CCCOC(C)=O)O4)O3)[C@H](C)C[C@H]2O1 |
| InChI | InChI=1S/C41H66O11Si/c1-26(22-27(2)38(28(3)25-47-31(6)43)51-53(10,11)39(7,8)9)36(44)37(45)35-24-34-33(48-35)23-29(4)41(50-34)20-19-40(52-41)18-15-17-32(49-40)16-13-12-14-21-46-30(5)42/h13,15-17,26-27,29,32-35,37-38,45H,3,12,14,18-25H2,1-2,4-11H3/b16-13+/t26-,27+,29-,32-,33-,34-,35+,37-,38+,40+,41-/m1/s1 |
| InChIKey | MXYGUUZXXHXONV-LRZXUSOASA-N |
| XLogP | 7.12 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.05 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|