C36H61IN2O6Si — CID 11468390
(3R,9S,11S,13R,14S,16S)-14-hydroxy-3-[[3-iodo-4-tri(propan-2-yl)silyloxyphenyl]methyl]-4,9,11,13-tetramethyl-16-propan-2-yl-1-oxa-4,7-diazacyclohexadecane-2,5,8-trione (PubChem CID 11468390) has the molecular formula C36H61IN2O6Si and a molecular weight of 772.88 g/mol. Its IUPAC name is (3R,9S,11S,13R,14S,16S)-14-hydroxy-3-[[3-iodo-4-tri(propan-2-yl)silyloxyphenyl]methyl]-4,9,11,13-tetramethyl-16-propan-2-yl-1-oxa-4,7-diazacyclohexadecane-2,5,8-trione.
| Compound Name | (3R,9S,11S,13R,14S,16S)-14-hydroxy-3-[[3-iodo-4-tri(propan-2-yl)silyloxyphenyl]methyl]-4,9,11,13-tetramethyl-16-propan-2-yl-1-oxa-4,7-diazacyclohexadecane-2,5,8-trione |
|---|---|
| PubChem CID | 11468390 |
| Molecular Formula | C36H61IN2O6Si |
| Molecular Weight | 772.88 g/mol |
| Exact Mass | 772.33 |
| IUPAC Name | (3R,9S,11S,13R,14S,16S)-14-hydroxy-3-[[3-iodo-4-tri(propan-2-yl)silyloxyphenyl]methyl]-4,9,11,13-tetramethyl-16-propan-2-yl-1-oxa-4,7-diazacyclohexadecane-2,5,8-trione |
| SMILES | CC(C)[C@@H]1C[C@H](O)[C@H](C)C[C@H](C)C[C@H](C)C(=O)NCC(=O)N(C)[C@H](Cc2ccc(O[Si](C(C)C)(C(C)C)C(C)C)c(I)c2)C(=O)O1 |
| InChI | InChI=1S/C36H61IN2O6Si/c1-21(2)33-19-31(40)26(10)15-25(9)16-27(11)35(42)38-20-34(41)39(12)30(36(43)44-33)18-28-13-14-32(29(37)17-28)45-46(22(3)4,23(5)6)24(7)8/h13-14,17,21-27,30-31,33,40H,15-16,18-20H2,1-12H3,(H,38,42)/t25-,26+,27-,30+,31-,33-/m0/s1 |
| InChIKey | LRHZFQQZECONTD-JLHOXGBRSA-N |
| XLogP | 7.35 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.88 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|