C52H56O2P2 — CID 11468396
[1-[2-bis(3,5-dimethylphenyl)phosphanyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-bis(3,5-dimethylphenyl)phosphane (PubChem CID 11468396) has the molecular formula C52H56O2P2 and a molecular weight of 774.97 g/mol. Its IUPAC name is [1-[2-bis(3,5-dimethylphenyl)phosphanyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-bis(3,5-dimethylphenyl)phosphane.
| Compound Name | [1-[2-bis(3,5-dimethylphenyl)phosphanyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-bis(3,5-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 11468396 |
| Molecular Formula | C52H56O2P2 |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.38 |
| IUPAC Name | [1-[2-bis(3,5-dimethylphenyl)phosphanyloxy-5,6,7,8-tetrahydronaphthalen-1-yl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy-bis(3,5-dimethylphenyl)phosphane |
| SMILES | Cc1cc(C)cc(P(Oc2ccc3c(c2-c2c(OP(c4cc(C)cc(C)c4)c4cc(C)cc(C)c4)ccc4c2CCCC4)CCCC3)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C52H56O2P2/c1-33-21-34(2)26-43(25-33)55(44-27-35(3)22-36(4)28-44)53-49-19-17-41-13-9-11-15-47(41)51(49)52-48-16-12-10-14-42(48)18-20-50(52)54-56(45-29-37(5)23-38(6)30-45)46-31-39(7)24-40(8)32-46/h17-32H,9-16H2,1-8H3 |
| InChIKey | MNBSMPCFOQAWDB-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|