C15H11F2N3O — CID 114684827
(3,4-difluorophenyl)-(3-phenyltriazol-4-yl)methanol (PubChem CID 114684827) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(3-phenyltriazol-4-yl)methanol.
| Compound Name | (3,4-difluorophenyl)-(3-phenyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 114684827 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | (3,4-difluorophenyl)-(3-phenyltriazol-4-yl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C15H11F2N3O/c16-12-7-6-10(8-13(12)17)15(21)14-9-18-19-20(14)11-4-2-1-3-5-11/h1-9,15,21H |
| InChIKey | NFABJUDYFHRUKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |