C14H19ClN4 — CID 114687105
2-(4-chlorophenyl)-N-methyl-1-(3-propyltriazol-4-yl)ethanamine (PubChem CID 114687105) has the molecular formula C14H19ClN4 and a molecular weight of 278.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-methyl-1-(3-propyltriazol-4-yl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-methyl-1-(3-propyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 114687105 |
| Molecular Formula | C14H19ClN4 |
| Molecular Weight | 278.79 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-methyl-1-(3-propyltriazol-4-yl)ethanamine |
| SMILES | CCCn1nncc1C(Cc1ccc(Cl)cc1)NC |
| InChI | InChI=1S/C14H19ClN4/c1-3-8-19-14(10-17-18-19)13(16-2)9-11-4-6-12(15)7-5-11/h4-7,10,13,16H,3,8-9H2,1-2H3 |
| InChIKey | RHEGXKTWFBPHAH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |