C16H24N4 — CID 114687752
N-ethyl-3,3-dimethyl-1-(3-phenyltriazol-4-yl)butan-1-amine (PubChem CID 114687752) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-1-(3-phenyltriazol-4-yl)butan-1-amine.
| Compound Name | N-ethyl-3,3-dimethyl-1-(3-phenyltriazol-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 114687752 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-ethyl-3,3-dimethyl-1-(3-phenyltriazol-4-yl)butan-1-amine |
| SMILES | CCNC(CC(C)(C)C)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H24N4/c1-5-17-14(11-16(2,3)4)15-12-18-19-20(15)13-9-7-6-8-10-13/h6-10,12,14,17H,5,11H2,1-4H3 |
| InChIKey | RRIHWYMXQKEVDM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |