C15H18N6 — CID 114687811
N-[(3-methyltriazol-4-yl)-quinoxalin-6-ylmethyl]propan-1-amine (PubChem CID 114687811) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(3-methyltriazol-4-yl)-quinoxalin-6-ylmethyl]propan-1-amine.
| Compound Name | N-[(3-methyltriazol-4-yl)-quinoxalin-6-ylmethyl]propan-1-amine |
|---|---|
| PubChem CID | 114687811 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[(3-methyltriazol-4-yl)-quinoxalin-6-ylmethyl]propan-1-amine |
| SMILES | CCCNC(c1ccc2nccnc2c1)c1cnnn1C |
| InChI | InChI=1S/C15H18N6/c1-3-6-18-15(14-10-19-20-21(14)2)11-4-5-12-13(9-11)17-8-7-16-12/h4-5,7-10,15,18H,3,6H2,1-2H3 |
| InChIKey | GGOSFLXHPLXRPG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |