C7H10N6 — CID 114688680
1H-imidazol-2-yl-(3-methyltriazol-4-yl)methanamine (PubChem CID 114688680) has the molecular formula C7H10N6 and a molecular weight of 178.20 g/mol. Its IUPAC name is 1H-imidazol-2-yl-(3-methyltriazol-4-yl)methanamine.
| Compound Name | 1H-imidazol-2-yl-(3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114688680 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1H-imidazol-2-yl-(3-methyltriazol-4-yl)methanamine |
| SMILES | Cn1nncc1C(N)c1ncc[nH]1 |
| InChI | InChI=1S/C7H10N6/c1-13-5(4-11-12-13)6(8)7-9-2-3-10-7/h2-4,6H,8H2,1H3,(H,9,10) |
| InChIKey | IOGLWJXFOXMIFN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |