C13H18N4 — CID 114690435
N,2-dimethyl-3-(3-phenyltriazol-4-yl)propan-1-amine (PubChem CID 114690435) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is N,2-dimethyl-3-(3-phenyltriazol-4-yl)propan-1-amine.
| Compound Name | N,2-dimethyl-3-(3-phenyltriazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 114690435 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N,2-dimethyl-3-(3-phenyltriazol-4-yl)propan-1-amine |
| SMILES | CNCC(C)Cc1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H18N4/c1-11(9-14-2)8-13-10-15-16-17(13)12-6-4-3-5-7-12/h3-7,10-11,14H,8-9H2,1-2H3 |
| InChIKey | HBCBGWQAFCIYDL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |