C16H20N4 — CID 114690501
5,5-dimethyl-3-(3-phenyltriazol-4-yl)cyclohex-2-en-1-amine (PubChem CID 114690501) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-(3-phenyltriazol-4-yl)cyclohex-2-en-1-amine.
| Compound Name | 5,5-dimethyl-3-(3-phenyltriazol-4-yl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 114690501 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5,5-dimethyl-3-(3-phenyltriazol-4-yl)cyclohex-2-en-1-amine |
| SMILES | CC1(C)CC(c2cnnn2-c2ccccc2)=CC(N)C1 |
| InChI | InChI=1S/C16H20N4/c1-16(2)9-12(8-13(17)10-16)15-11-18-19-20(15)14-6-4-3-5-7-14/h3-8,11,13H,9-10,17H2,1-2H3 |
| InChIKey | GNLAPCVRWDSNLV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |